C16H15FNO3S- — CID 174539897
[2-(3,4-dihydro-2H-chromen-4-ylamino)-4-fluorophenyl]methanesulfinate (PubChem CID 174539897) has the molecular formula C16H15FNO3S- and a molecular weight of 320.37 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-ylamino)-4-fluorophenyl]methanesulfinate.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-4-fluorophenyl]methanesulfinate |
|---|---|
| PubChem CID | 174539897 |
| Molecular Formula | C16H15FNO3S- |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-4-fluorophenyl]methanesulfinate |
| SMILES | O=S([O-])Cc1ccc(F)cc1NC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H16FNO3S/c17-12-6-5-11(10-22(19)20)15(9-12)18-14-7-8-21-16-4-2-1-3-13(14)16/h1-6,9,14,18H,7-8,10H2,(H,19,20)/p-1 |
| InChIKey | DCRADGGXQNGOHS-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|