C16H16FNO3S — CID 174539898
[2-(3,4-dihydro-2H-chromen-4-ylamino)-4-fluorophenyl]methanesulfinic acid (PubChem CID 174539898) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-ylamino)-4-fluorophenyl]methanesulfinic acid.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-4-fluorophenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174539898 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-4-fluorophenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(F)cc1NC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H16FNO3S/c17-12-6-5-11(10-22(19)20)15(9-12)18-14-7-8-21-16-4-2-1-3-13(14)16/h1-6,9,14,18H,7-8,10H2,(H,19,20) |
| InChIKey | DCRADGGXQNGOHS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|