C15H12BrF2NO — CID 43347570
N-(2-bromo-4,6-difluorophenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43347570) has the molecular formula C15H12BrF2NO and a molecular weight of 340.17 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43347570 |
| Molecular Formula | C15H12BrF2NO |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | Fc1cc(F)c(NC2CCOc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C15H12BrF2NO/c16-11-7-9(17)8-12(18)15(11)19-13-5-6-20-14-4-2-1-3-10(13)14/h1-4,7-8,13,19H,5-6H2 |
| InChIKey | JTJLSIASFYEGQW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |