C10H13Cl2N3 — CID 134359724
3,5-dichloro-N-piperidin-4-ylpyridin-4-amine (PubChem CID 134359724) has the molecular formula C10H13Cl2N3 and a molecular weight of 246.14 g/mol. Its IUPAC name is 3,5-dichloro-N-piperidin-4-ylpyridin-4-amine.
| Compound Name | 3,5-dichloro-N-piperidin-4-ylpyridin-4-amine |
|---|---|
| PubChem CID | 134359724 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3,5-dichloro-N-piperidin-4-ylpyridin-4-amine |
| SMILES | Clc1cncc(Cl)c1NC1CCNCC1 |
| InChI | InChI=1S/C10H13Cl2N3/c11-8-5-14-6-9(12)10(8)15-7-1-3-13-4-2-7/h5-7,13H,1-4H2,(H,14,15) |
| InChIKey | RYIWADATUCJLHH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |