C8H13N3S — CID 164646465
N-piperidin-4-yl-1,2-thiazol-4-amine (PubChem CID 164646465) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is N-piperidin-4-yl-1,2-thiazol-4-amine.
| Compound Name | N-piperidin-4-yl-1,2-thiazol-4-amine |
|---|---|
| PubChem CID | 164646465 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-piperidin-4-yl-1,2-thiazol-4-amine |
| SMILES | c1nscc1NC1CCNCC1 |
| InChI | InChI=1S/C8H13N3S/c1-3-9-4-2-7(1)11-8-5-10-12-6-8/h5-7,9,11H,1-4H2 |
| InChIKey | NIENPCTXCIGERW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |