C13H15BrN4S — CID 116974771
5-(4-bromothiophen-2-yl)-N-piperidin-4-ylpyrimidin-2-amine (PubChem CID 116974771) has the molecular formula C13H15BrN4S and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-(4-bromothiophen-2-yl)-N-piperidin-4-ylpyrimidin-2-amine.
| Compound Name | 5-(4-bromothiophen-2-yl)-N-piperidin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 116974771 |
| Molecular Formula | C13H15BrN4S |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 5-(4-bromothiophen-2-yl)-N-piperidin-4-ylpyrimidin-2-amine |
| SMILES | Brc1csc(-c2cnc(NC3CCNCC3)nc2)c1 |
| InChI | InChI=1S/C13H15BrN4S/c14-10-5-12(19-8-10)9-6-16-13(17-7-9)18-11-1-3-15-4-2-11/h5-8,11,15H,1-4H2,(H,16,17,18) |
| InChIKey | CPEZAQSRXYJXKC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |