C12H13BrN2S2 — CID 107354701
4-(4-bromothiophen-2-yl)-2-piperidin-4-yl-1,3-thiazole (PubChem CID 107354701) has the molecular formula C12H13BrN2S2 and a molecular weight of 329.29 g/mol. Its IUPAC name is 4-(4-bromothiophen-2-yl)-2-piperidin-4-yl-1,3-thiazole.
| Compound Name | 4-(4-bromothiophen-2-yl)-2-piperidin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 107354701 |
| Molecular Formula | C12H13BrN2S2 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 4-(4-bromothiophen-2-yl)-2-piperidin-4-yl-1,3-thiazole |
| SMILES | Brc1csc(-c2csc(C3CCNCC3)n2)c1 |
| InChI | InChI=1S/C12H13BrN2S2/c13-9-5-11(16-6-9)10-7-17-12(15-10)8-1-3-14-4-2-8/h5-8,14H,1-4H2 |
| InChIKey | LHZPZDWNPQEWIT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |