C10H15BrN4 — CID 106996112
5-bromo-N-(2-methylpiperidin-4-yl)pyrimidin-2-amine (PubChem CID 106996112) has the molecular formula C10H15BrN4 and a molecular weight of 271.16 g/mol. Its IUPAC name is 5-bromo-N-(2-methylpiperidin-4-yl)pyrimidin-2-amine.
| Compound Name | 5-bromo-N-(2-methylpiperidin-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106996112 |
| Molecular Formula | C10H15BrN4 |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 5-bromo-N-(2-methylpiperidin-4-yl)pyrimidin-2-amine |
| SMILES | CC1CC(Nc2ncc(Br)cn2)CCN1 |
| InChI | InChI=1S/C10H15BrN4/c1-7-4-9(2-3-12-7)15-10-13-5-8(11)6-14-10/h5-7,9,12H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | DRAPITTYGZWOHT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |