C9H15N3S — CID 106996268
N-(2-methylpiperidin-4-yl)-1,3-thiazol-2-amine (PubChem CID 106996268) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-methylpiperidin-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106996268 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-1,3-thiazol-2-amine |
| SMILES | CC1CC(Nc2nccs2)CCN1 |
| InChI | InChI=1S/C9H15N3S/c1-7-6-8(2-3-10-7)12-9-11-4-5-13-9/h4-5,7-8,10H,2-3,6H2,1H3,(H,11,12) |
| InChIKey | KOTAXOVGRWHRFB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |