C6H8N2OS — CID 163452036
N-(3-methyloxiran-2-yl)-1,3-thiazol-2-amine (PubChem CID 163452036) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is N-(3-methyloxiran-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(3-methyloxiran-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 163452036 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | N-(3-methyloxiran-2-yl)-1,3-thiazol-2-amine |
| SMILES | CC1OC1Nc1nccs1 |
| InChI | InChI=1S/C6H8N2OS/c1-4-5(9-4)8-6-7-2-3-10-6/h2-5H,1H3,(H,7,8) |
| InChIKey | BHKHHNDBRPSYGV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 37.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|