C6H9N3S — CID 66187030
N-(azetidin-3-yl)-1,3-thiazol-2-amine (PubChem CID 66187030) has the molecular formula C6H9N3S and a molecular weight of 155.23 g/mol. Its IUPAC name is N-(azetidin-3-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(azetidin-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 66187030 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | N-(azetidin-3-yl)-1,3-thiazol-2-amine |
| SMILES | c1csc(NC2CNC2)n1 |
| InChI | InChI=1S/C6H9N3S/c1-2-10-6(8-1)9-5-3-7-4-5/h1-2,5,7H,3-4H2,(H,8,9) |
| InChIKey | KIJTZENOBQIHLA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |