C10H18N4O2S2 — CID 166226223
N,N-dimethyl-4-(1,3-thiazol-2-ylamino)piperidine-1-sulfonamide (PubChem CID 166226223) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N,N-dimethyl-4-(1,3-thiazol-2-ylamino)piperidine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(1,3-thiazol-2-ylamino)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 166226223 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N,N-dimethyl-4-(1,3-thiazol-2-ylamino)piperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(Nc2nccs2)CC1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-13(2)18(15,16)14-6-3-9(4-7-14)12-10-11-5-8-17-10/h5,8-9H,3-4,6-7H2,1-2H3,(H,11,12) |
| InChIKey | LVXNIKITROFZHF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |