C8H11N3OS — CID 130159323
1-methyl-4-(1,3-thiazol-2-ylamino)pyrrolidin-2-one (PubChem CID 130159323) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 1-methyl-4-(1,3-thiazol-2-ylamino)pyrrolidin-2-one.
| Compound Name | 1-methyl-4-(1,3-thiazol-2-ylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 130159323 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 1-methyl-4-(1,3-thiazol-2-ylamino)pyrrolidin-2-one |
| SMILES | CN1CC(Nc2nccs2)CC1=O |
| InChI | InChI=1S/C8H11N3OS/c1-11-5-6(4-7(11)12)10-8-9-2-3-13-8/h2-3,6H,4-5H2,1H3,(H,9,10) |
| InChIKey | DAIRBMXMORLOMT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |