C8H13N3S — CID 71637319
N-[(3R)-piperidin-3-yl]-1,3-thiazol-2-amine (PubChem CID 71637319) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is N-[(3R)-piperidin-3-yl]-1,3-thiazol-2-amine.
| Compound Name | N-[(3R)-piperidin-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 71637319 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-[(3R)-piperidin-3-yl]-1,3-thiazol-2-amine |
| SMILES | c1csc(N[C@@H]2CCCNC2)n1 |
| InChI | InChI=1S/C8H13N3S/c1-2-7(6-9-3-1)11-8-10-4-5-12-8/h4-5,7,9H,1-3,6H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | PYHVUKAETJNSST-SSDOTTSWSA-N |
| XLogP | 1.31 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |