About N-piperidin-3-yl-1,3-oxazol-2-amine
N-piperidin-3-yl-1,3-oxazol-2-amine (PubChem CID 112709406) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-piperidin-3-yl-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | N-piperidin-3-yl-1,3-oxazol-2-amine |
| PubChem CID | 112709406 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-piperidin-3-yl-1,3-oxazol-2-amine |
| SMILES | c1coc(NC2CCCNC2)n1 |
| InChI | InChI=1S/C8H13N3O/c1-2-7(6-9-3-1)11-8-10-4-5-12-8/h4-5,7,9H,1-3,6H2,(H,10,11) |
| InChIKey | KTGGTAZFFPPICL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-piperidin-3-yl-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-3-yl-1,3-oxazol-2-amine?
The IUPAC name of N-piperidin-3-yl-1,3-oxazol-2-amine (CID 112709406) is N-piperidin-3-yl-1,3-oxazol-2-amine.
What is the SMILES notation for N-piperidin-3-yl-1,3-oxazol-2-amine?
The canonical SMILES for N-piperidin-3-yl-1,3-oxazol-2-amine is c1coc(NC2CCCNC2)n1.
What is the InChIKey of N-piperidin-3-yl-1,3-oxazol-2-amine?
The InChIKey is KTGGTAZFFPPICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-2-7(6-9-3-1)11-8-10-4-5-12-8/h4-5,7,9H,1-3,6H2,(H,10,11).
What are the key properties of N-piperidin-3-yl-1,3-oxazol-2-amine?
N-piperidin-3-yl-1,3-oxazol-2-amine has a molecular weight of 167.21 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-3-yl-1,3-oxazol-2-amine is sourced from PubChem (CID 112709406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).