C10H17ClN4 — CID 71639312
3-methyl-N-piperidin-3-ylpyrazin-2-amine;hydrochloride (PubChem CID 71639312) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is 3-methyl-N-piperidin-3-ylpyrazin-2-amine;hydrochloride.
| Compound Name | 3-methyl-N-piperidin-3-ylpyrazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71639312 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 3-methyl-N-piperidin-3-ylpyrazin-2-amine;hydrochloride |
| SMILES | Cc1nccnc1NC1CCCNC1.Cl |
| InChI | InChI=1S/C10H16N4.ClH/c1-8-10(13-6-5-12-8)14-9-3-2-4-11-7-9;/h5-6,9,11H,2-4,7H2,1H3,(H,13,14);1H |
| InChIKey | LAQOOPZUCJLTKZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |