C13H17N3S — CID 172533104
3-methyl-N-[(3R)-piperidin-3-yl]thieno[3,2-c]pyridin-4-amine (PubChem CID 172533104) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 3-methyl-N-[(3R)-piperidin-3-yl]thieno[3,2-c]pyridin-4-amine.
| Compound Name | 3-methyl-N-[(3R)-piperidin-3-yl]thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 172533104 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-methyl-N-[(3R)-piperidin-3-yl]thieno[3,2-c]pyridin-4-amine |
| SMILES | Cc1csc2ccnc(N[C@@H]3CCCNC3)c12 |
| InChI | InChI=1S/C13H17N3S/c1-9-8-17-11-4-6-15-13(12(9)11)16-10-3-2-5-14-7-10/h4,6,8,10,14H,2-3,5,7H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | GKKRDJCUHTZBGU-SNVBAGLBSA-N |
| XLogP | 2.77 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |