C10H17N3O — CID 83484641
N-(1-methylazepan-3-yl)-1,3-oxazol-2-amine (PubChem CID 83484641) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(1-methylazepan-3-yl)-1,3-oxazol-2-amine.
| Compound Name | N-(1-methylazepan-3-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 83484641 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-(1-methylazepan-3-yl)-1,3-oxazol-2-amine |
| SMILES | CN1CCCCC(Nc2ncco2)C1 |
| InChI | InChI=1S/C10H17N3O/c1-13-6-3-2-4-9(8-13)12-10-11-5-7-14-10/h5,7,9H,2-4,6,8H2,1H3,(H,11,12) |
| InChIKey | OUGUQJFZQJTRJD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |