C8H12N2OS2 — CID 97166120
2-[(R)-[(3R)-piperidin-3-yl]sulfinyl]-1,3-thiazole (PubChem CID 97166120) has the molecular formula C8H12N2OS2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-[(R)-[(3R)-piperidin-3-yl]sulfinyl]-1,3-thiazole.
| Compound Name | 2-[(R)-[(3R)-piperidin-3-yl]sulfinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97166120 |
| Molecular Formula | C8H12N2OS2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-[(R)-[(3R)-piperidin-3-yl]sulfinyl]-1,3-thiazole |
| SMILES | O=[S@@](c1nccs1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C8H12N2OS2/c11-13(8-10-4-5-12-8)7-2-1-3-9-6-7/h4-5,7,9H,1-3,6H2/t7-,13-/m1/s1 |
| InChIKey | WFUIYFJQEJYKGO-FUXBKTLASA-N |
| XLogP | 1.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |