C11H13N3OS — CID 71645971
2-piperidin-3-ylsulfinylpyridine-3-carbonitrile (PubChem CID 71645971) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-piperidin-3-ylsulfinylpyridine-3-carbonitrile.
| Compound Name | 2-piperidin-3-ylsulfinylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71645971 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-piperidin-3-ylsulfinylpyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1S(=O)C1CCCNC1 |
| InChI | InChI=1S/C11H13N3OS/c12-7-9-3-1-6-14-11(9)16(15)10-4-2-5-13-8-10/h1,3,6,10,13H,2,4-5,8H2 |
| InChIKey | FJWJMJGPCGBGPP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |