C12H15N3O2S — CID 97165976
2-[[(3S)-piperidin-3-yl]methylsulfonyl]pyridine-3-carbonitrile (PubChem CID 97165976) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-[[(3S)-piperidin-3-yl]methylsulfonyl]pyridine-3-carbonitrile.
| Compound Name | 2-[[(3S)-piperidin-3-yl]methylsulfonyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 97165976 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[[(3S)-piperidin-3-yl]methylsulfonyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1S(=O)(=O)C[C@H]1CCCNC1 |
| InChI | InChI=1S/C12H15N3O2S/c13-7-11-4-2-6-15-12(11)18(16,17)9-10-3-1-5-14-8-10/h2,4,6,10,14H,1,3,5,8-9H2/t10-/m0/s1 |
| InChIKey | RQKCIERQUILDMN-JTQLQIEISA-N |
| XLogP | 0.73 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |