C12H16ClN3O2S — CID 71645669
2-(piperidin-2-ylmethylsulfonyl)pyridine-3-carbonitrile;hydrochloride (PubChem CID 71645669) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 2-(piperidin-2-ylmethylsulfonyl)pyridine-3-carbonitrile;hydrochloride.
| Compound Name | 2-(piperidin-2-ylmethylsulfonyl)pyridine-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 71645669 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(piperidin-2-ylmethylsulfonyl)pyridine-3-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccnc1S(=O)(=O)CC1CCCCN1 |
| InChI | InChI=1S/C12H15N3O2S.ClH/c13-8-10-4-3-7-15-12(10)18(16,17)9-11-5-1-2-6-14-11;/h3-4,7,11,14H,1-2,5-6,9H2;1H |
| InChIKey | QBWGGRATSFBTQQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |