C14H16ClN3O2S — CID 71639761
2-chloro-3-(piperidin-2-ylmethylsulfonyl)quinoxaline (PubChem CID 71639761) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-chloro-3-(piperidin-2-ylmethylsulfonyl)quinoxaline.
| Compound Name | 2-chloro-3-(piperidin-2-ylmethylsulfonyl)quinoxaline |
|---|---|
| PubChem CID | 71639761 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-chloro-3-(piperidin-2-ylmethylsulfonyl)quinoxaline |
| SMILES | O=S(=O)(CC1CCCCN1)c1nc2ccccc2nc1Cl |
| InChI | InChI=1S/C14H16ClN3O2S/c15-13-14(18-12-7-2-1-6-11(12)17-13)21(19,20)9-10-5-3-4-8-16-10/h1-2,6-7,10,16H,3-5,8-9H2 |
| InChIKey | YIXIAMRTEJOVKA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |