C11H13Cl2NO2S — CID 134086021
2-[(2,6-dichlorophenyl)sulfonylmethyl]pyrrolidine (PubChem CID 134086021) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)sulfonylmethyl]pyrrolidine.
| Compound Name | 2-[(2,6-dichlorophenyl)sulfonylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 134086021 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)sulfonylmethyl]pyrrolidine |
| SMILES | O=S(=O)(CC1CCCN1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO2S/c12-9-4-1-5-10(13)11(9)17(15,16)7-8-3-2-6-14-8/h1,4-5,8,14H,2-3,6-7H2 |
| InChIKey | UACXXGOLEAOXFU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |