C13H15ClN4 — CID 97164043
3-chloro-N-[[(2S)-pyrrolidin-2-yl]methyl]quinoxalin-2-amine (PubChem CID 97164043) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 3-chloro-N-[[(2S)-pyrrolidin-2-yl]methyl]quinoxalin-2-amine.
| Compound Name | 3-chloro-N-[[(2S)-pyrrolidin-2-yl]methyl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 97164043 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-chloro-N-[[(2S)-pyrrolidin-2-yl]methyl]quinoxalin-2-amine |
| SMILES | Clc1nc2ccccc2nc1NC[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H15ClN4/c14-12-13(16-8-9-4-3-7-15-9)18-11-6-2-1-5-10(11)17-12/h1-2,5-6,9,15H,3-4,7-8H2,(H,16,18)/t9-/m0/s1 |
| InChIKey | FDKJCPZZEZDEFK-VIFPVBQESA-N |
| XLogP | 2.45 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |