C13H19ClN4 — CID 71636788
N-(piperidin-2-ylmethyl)-1H-benzimidazol-2-amine;hydrochloride (PubChem CID 71636788) has the molecular formula C13H19ClN4 and a molecular weight of 266.78 g/mol. Its IUPAC name is N-(piperidin-2-ylmethyl)-1H-benzimidazol-2-amine;hydrochloride.
| Compound Name | N-(piperidin-2-ylmethyl)-1H-benzimidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71636788 |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(piperidin-2-ylmethyl)-1H-benzimidazol-2-amine;hydrochloride |
| SMILES | Cl.c1ccc2[nH]c(NCC3CCCCN3)nc2c1 |
| InChI | InChI=1S/C13H18N4.ClH/c1-2-7-12-11(6-1)16-13(17-12)15-9-10-5-3-4-8-14-10;/h1-2,6-7,10,14H,3-5,8-9H2,(H2,15,16,17);1H |
| InChIKey | HNUVGQGOLTXENS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |