C11H15N5 — CID 80515109
3-(piperidin-2-ylmethylamino)pyridazine-4-carbonitrile (PubChem CID 80515109) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-(piperidin-2-ylmethylamino)pyridazine-4-carbonitrile.
| Compound Name | 3-(piperidin-2-ylmethylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80515109 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-(piperidin-2-ylmethylamino)pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1NCC1CCCCN1 |
| InChI | InChI=1S/C11H15N5/c12-7-9-4-6-15-16-11(9)14-8-10-3-1-2-5-13-10/h4,6,10,13H,1-3,5,8H2,(H,14,16) |
| InChIKey | LKKXZGTYQYXBLO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |