C14H21N5 — CID 106641449
3-[piperidin-2-ylmethyl(propan-2-yl)amino]pyridazine-4-carbonitrile (PubChem CID 106641449) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 3-[piperidin-2-ylmethyl(propan-2-yl)amino]pyridazine-4-carbonitrile.
| Compound Name | 3-[piperidin-2-ylmethyl(propan-2-yl)amino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 106641449 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 3-[piperidin-2-ylmethyl(propan-2-yl)amino]pyridazine-4-carbonitrile |
| SMILES | CC(C)N(CC1CCCCN1)c1nnccc1C#N |
| InChI | InChI=1S/C14H21N5/c1-11(2)19(10-13-5-3-4-7-16-13)14-12(9-15)6-8-17-18-14/h6,8,11,13,16H,3-5,7,10H2,1-2H3 |
| InChIKey | LJVXFOYZYCUKPY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |