C13H13N5 — CID 80514883
3-[2-(4-aminophenyl)ethylamino]pyridazine-4-carbonitrile (PubChem CID 80514883) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)ethylamino]pyridazine-4-carbonitrile.
| Compound Name | 3-[2-(4-aminophenyl)ethylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80514883 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-[2-(4-aminophenyl)ethylamino]pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1NCCc1ccc(N)cc1 |
| InChI | InChI=1S/C13H13N5/c14-9-11-6-8-17-18-13(11)16-7-5-10-1-3-12(15)4-2-10/h1-4,6,8H,5,7,15H2,(H,16,18) |
| InChIKey | RHEVDTBZEIMCRL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|