C11H9ClN4S — CID 106034912
3-[2-(5-chlorothiophen-2-yl)ethylamino]pyridazine-4-carbonitrile (PubChem CID 106034912) has the molecular formula C11H9ClN4S and a molecular weight of 264.74 g/mol. Its IUPAC name is 3-[2-(5-chlorothiophen-2-yl)ethylamino]pyridazine-4-carbonitrile.
| Compound Name | 3-[2-(5-chlorothiophen-2-yl)ethylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 106034912 |
| Molecular Formula | C11H9ClN4S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 3-[2-(5-chlorothiophen-2-yl)ethylamino]pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H9ClN4S/c12-10-2-1-9(17-10)4-5-14-11-8(7-13)3-6-15-16-11/h1-3,6H,4-5H2,(H,14,16) |
| InChIKey | ZGDCSVRJBPYLDB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |