C11H13N3S — CID 71643645
2-(pyrrolidin-2-ylmethylsulfanyl)pyridine-3-carbonitrile (PubChem CID 71643645) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-(pyrrolidin-2-ylmethylsulfanyl)pyridine-3-carbonitrile.
| Compound Name | 2-(pyrrolidin-2-ylmethylsulfanyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71643645 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-(pyrrolidin-2-ylmethylsulfanyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1SCC1CCCN1 |
| InChI | InChI=1S/C11H13N3S/c12-7-9-3-1-6-14-11(9)15-8-10-4-2-5-13-10/h1,3,6,10,13H,2,4-5,8H2 |
| InChIKey | BUFUQRGSAWPNFZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |