C11H18ClN3O2S — CID 71638944
4-methyl-2-(piperidin-2-ylmethylsulfonyl)pyrimidine;hydrochloride (PubChem CID 71638944) has the molecular formula C11H18ClN3O2S and a molecular weight of 291.80 g/mol. Its IUPAC name is 4-methyl-2-(piperidin-2-ylmethylsulfonyl)pyrimidine;hydrochloride.
| Compound Name | 4-methyl-2-(piperidin-2-ylmethylsulfonyl)pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 71638944 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-methyl-2-(piperidin-2-ylmethylsulfonyl)pyrimidine;hydrochloride |
| SMILES | Cc1ccnc(S(=O)(=O)CC2CCCCN2)n1.Cl |
| InChI | InChI=1S/C11H17N3O2S.ClH/c1-9-5-7-13-11(14-9)17(15,16)8-10-4-2-3-6-12-10;/h5,7,10,12H,2-4,6,8H2,1H3;1H |
| InChIKey | BGTQLMNSQGMBBR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |