C10H16ClN3O2S — CID 71645679
2-(piperidin-2-ylmethylsulfonyl)pyrazine;hydrochloride (PubChem CID 71645679) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is 2-(piperidin-2-ylmethylsulfonyl)pyrazine;hydrochloride.
| Compound Name | 2-(piperidin-2-ylmethylsulfonyl)pyrazine;hydrochloride |
|---|---|
| PubChem CID | 71645679 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-(piperidin-2-ylmethylsulfonyl)pyrazine;hydrochloride |
| SMILES | Cl.O=S(=O)(CC1CCCCN1)c1cnccn1 |
| InChI | InChI=1S/C10H15N3O2S.ClH/c14-16(15,10-7-11-5-6-13-10)8-9-3-1-2-4-12-9;/h5-7,9,12H,1-4,8H2;1H |
| InChIKey | VFOOZNSRUBVURY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |