C10H12ClN3OS — CID 170987698
2-[(S)-[(3R)-pyrrolidin-3-yl]sulfinyl]pyridine-3-carbonitrile;hydrochloride (PubChem CID 170987698) has the molecular formula C10H12ClN3OS and a molecular weight of 257.75 g/mol. Its IUPAC name is 2-[(S)-[(3R)-pyrrolidin-3-yl]sulfinyl]pyridine-3-carbonitrile;hydrochloride.
| Compound Name | 2-[(S)-[(3R)-pyrrolidin-3-yl]sulfinyl]pyridine-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 170987698 |
| Molecular Formula | C10H12ClN3OS |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-[(S)-[(3R)-pyrrolidin-3-yl]sulfinyl]pyridine-3-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccnc1[S@@](=O)[C@@H]1CCNC1 |
| InChI | InChI=1S/C10H11N3OS.ClH/c11-6-8-2-1-4-13-10(8)15(14)9-3-5-12-7-9;/h1-2,4,9,12H,3,5,7H2;1H/t9-,15+;/m1./s1 |
| InChIKey | MVWIPIKYANDPAQ-HPPVRDKUSA-N |
| XLogP | 0.84 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |