C10H15ClN2OS — CID 71645974
2-piperidin-3-ylsulfinylpyridine;hydrochloride (PubChem CID 71645974) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is 2-piperidin-3-ylsulfinylpyridine;hydrochloride.
| Compound Name | 2-piperidin-3-ylsulfinylpyridine;hydrochloride |
|---|---|
| PubChem CID | 71645974 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-piperidin-3-ylsulfinylpyridine;hydrochloride |
| SMILES | Cl.O=S(c1ccccn1)C1CCCNC1 |
| InChI | InChI=1S/C10H14N2OS.ClH/c13-14(9-4-3-6-11-8-9)10-5-1-2-7-12-10;/h1-2,5,7,9,11H,3-4,6,8H2;1H |
| InChIKey | WXBUKDAMRDJRPV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |