About 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one
5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one (PubChem CID 102768578) has the molecular formula C9H14N4OS
and a molecular weight of 226.30 g/mol. Its IUPAC name is 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one |
| PubChem CID | 102768578 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one |
| SMILES | CN1CC(Nc2ncc(N)s2)CCC1=O |
| InChI | InChI=1S/C9H14N4OS/c1-13-5-6(2-3-8(13)14)12-9-11-4-7(10)15-9/h4,6H,2-3,5,10H2,1H3,(H,11,12) |
| InChIKey | HOYFIJBTRJAJRY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one?
The IUPAC name of 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one (CID 102768578) is 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one.
What is the SMILES notation for 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one?
The canonical SMILES for 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one is CN1CC(Nc2ncc(N)s2)CCC1=O.
What is the InChIKey of 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one?
The InChIKey is HOYFIJBTRJAJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4OS/c1-13-5-6(2-3-8(13)14)12-9-11-4-7(10)15-9/h4,6H,2-3,5,10H2,1H3,(H,11,12).
What are the key properties of 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one?
5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one has a molecular weight of 226.30 g/mol, XLogP of 0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-amino-1,3-thiazol-2-yl)amino]-1-methylpiperidin-2-one is sourced from PubChem (CID 102768578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).