About 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine
2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine (PubChem CID 102768646) has the molecular formula C9H13N3S
and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine |
| PubChem CID | 102768646 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(NC2CC=CCC2)s1 |
| InChI | InChI=1S/C9H13N3S/c10-8-6-11-9(13-8)12-7-4-2-1-3-5-7/h1-2,6-7H,3-5,10H2,(H,11,12) |
| InChIKey | YVHVAWWNMGCXMA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine?
The IUPAC name of 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine (CID 102768646) is 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine.
What is the SMILES notation for 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine?
The canonical SMILES for 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine is Nc1cnc(NC2CC=CCC2)s1.
What is the InChIKey of 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine?
The InChIKey is YVHVAWWNMGCXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3S/c10-8-6-11-9(13-8)12-7-4-2-1-3-5-7/h1-2,6-7H,3-5,10H2,(H,11,12).
What are the key properties of 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine?
2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine has a molecular weight of 195.29 g/mol, XLogP of 2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine is sourced from PubChem (CID 102768646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).