C9H13N3S — CID 102768646
2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine (PubChem CID 102768646) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102768646 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-N-cyclohex-3-en-1-yl-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(NC2CC=CCC2)s1 |
| InChI | InChI=1S/C9H13N3S/c10-8-6-11-9(13-8)12-7-4-2-1-3-5-7/h1-2,6-7H,3-5,10H2,(H,11,12) |
| InChIKey | YVHVAWWNMGCXMA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|