C10H15N3S — CID 130617251
5-[(cyclohex-3-en-1-ylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 130617251) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 5-[(cyclohex-3-en-1-ylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(cyclohex-3-en-1-ylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130617251 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 5-[(cyclohex-3-en-1-ylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CNC2CC=CCC2)s1 |
| InChI | InChI=1S/C10H15N3S/c11-10-13-7-9(14-10)6-12-8-4-2-1-3-5-8/h1-2,7-8,12H,3-6H2,(H2,11,13) |
| InChIKey | LUIPSWWHTQPCDY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|