C11H17N3 — CID 130948462
N-[(4-methyl-1H-pyrazol-5-yl)methyl]cyclohex-3-en-1-amine (PubChem CID 130948462) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-[(4-methyl-1H-pyrazol-5-yl)methyl]cyclohex-3-en-1-amine.
| Compound Name | N-[(4-methyl-1H-pyrazol-5-yl)methyl]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 130948462 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-[(4-methyl-1H-pyrazol-5-yl)methyl]cyclohex-3-en-1-amine |
| SMILES | Cc1cn[nH]c1CNC1CC=CCC1 |
| InChI | InChI=1S/C11H17N3/c1-9-7-13-14-11(9)8-12-10-5-3-2-4-6-10/h2-3,7,10,12H,4-6,8H2,1H3,(H,13,14) |
| InChIKey | CWMWLLUYMKXQMV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|