C17H23FN4 — CID 154807954
1-(4-fluoro-2-methylphenyl)-N-[(4-methyl-1H-pyrazol-5-yl)methyl]piperidin-3-amine (PubChem CID 154807954) has the molecular formula C17H23FN4 and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-N-[(4-methyl-1H-pyrazol-5-yl)methyl]piperidin-3-amine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-N-[(4-methyl-1H-pyrazol-5-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 154807954 |
| Molecular Formula | C17H23FN4 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-N-[(4-methyl-1H-pyrazol-5-yl)methyl]piperidin-3-amine |
| SMILES | Cc1cc(F)ccc1N1CCCC(NCc2[nH]ncc2C)C1 |
| InChI | InChI=1S/C17H23FN4/c1-12-8-14(18)5-6-17(12)22-7-3-4-15(11-22)19-10-16-13(2)9-20-21-16/h5-6,8-9,15,19H,3-4,7,10-11H2,1-2H3,(H,20,21) |
| InChIKey | GHGCWEAIZCUZGK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |