C19H22FN5 — CID 45230292
N-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine (PubChem CID 45230292) has the molecular formula C19H22FN5 and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine.
| Compound Name | N-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 45230292 |
| Molecular Formula | C19H22FN5 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
| SMILES | Cc1c(CNC2CCCN(c3ncccn3)C2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C19H22FN5/c1-13-16-10-14(20)5-6-17(16)24-18(13)11-23-15-4-2-9-25(12-15)19-21-7-3-8-22-19/h3,5-8,10,15,23-24H,2,4,9,11-12H2,1H3 |
| InChIKey | NQJICUNREGEXIH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|