C19H21FN6 — CID 42196033
(3R)-N-[(5-fluoro-2-pyrazol-1-ylphenyl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine (PubChem CID 42196033) has the molecular formula C19H21FN6 and a molecular weight of 352.42 g/mol. Its IUPAC name is (3R)-N-[(5-fluoro-2-pyrazol-1-ylphenyl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine.
| Compound Name | (3R)-N-[(5-fluoro-2-pyrazol-1-ylphenyl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 42196033 |
| Molecular Formula | C19H21FN6 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3R)-N-[(5-fluoro-2-pyrazol-1-ylphenyl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
| SMILES | Fc1ccc(-n2cccn2)c(CN[C@@H]2CCCN(c3ncccn3)C2)c1 |
| InChI | InChI=1S/C19H21FN6/c20-16-5-6-18(26-11-3-9-24-26)15(12-16)13-23-17-4-1-10-25(14-17)19-21-7-2-8-22-19/h2-3,5-9,11-12,17,23H,1,4,10,13-14H2/t17-/m1/s1 |
| InChIKey | WQRNYJFFXIWWLD-QGZVFWFLSA-N |
| XLogP | 2.56 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |