C12H14FN3 — CID 43314015
N-[(5-fluoro-2-pyrazol-1-ylphenyl)methyl]ethanamine (PubChem CID 43314015) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is N-[(5-fluoro-2-pyrazol-1-ylphenyl)methyl]ethanamine.
| Compound Name | N-[(5-fluoro-2-pyrazol-1-ylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43314015 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | N-[(5-fluoro-2-pyrazol-1-ylphenyl)methyl]ethanamine |
| SMILES | CCNCc1cc(F)ccc1-n1cccn1 |
| InChI | InChI=1S/C12H14FN3/c1-2-14-9-10-8-11(13)4-5-12(10)16-7-3-6-15-16/h3-8,14H,2,9H2,1H3 |
| InChIKey | VXSXHMADEQURQI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |