C17H21FN4 — CID 133304646
N-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]-4-methylpyrimidin-2-amine (PubChem CID 133304646) has the molecular formula C17H21FN4 and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]-4-methylpyrimidin-2-amine.
| Compound Name | N-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 133304646 |
| Molecular Formula | C17H21FN4 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]-4-methylpyrimidin-2-amine |
| SMILES | Cc1ccnc(NC2CCCN(c3ccc(F)cc3C)C2)n1 |
| InChI | InChI=1S/C17H21FN4/c1-12-10-14(18)5-6-16(12)22-9-3-4-15(11-22)21-17-19-8-7-13(2)20-17/h5-8,10,15H,3-4,9,11H2,1-2H3,(H,19,20,21) |
| InChIKey | OSRJGBGWSMHFGQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |