About [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol
[2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol (PubChem CID 154741364) has the molecular formula C15H16F2N4O
and a molecular weight of 306.32 g/mol. Its IUPAC name is [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol |
| PubChem CID | 154741364 |
| Molecular Formula | C15H16F2N4O |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol |
| SMILES | OCc1ccnc(NC2CCN(c3ccc(F)cc3F)C2)n1 |
| InChI | InChI=1S/C15H16F2N4O/c16-10-1-2-14(13(17)7-10)21-6-4-11(8-21)19-15-18-5-3-12(9-22)20-15/h1-3,5,7,11,22H,4,6,8-9H2,(H,18,19,20) |
| InChIKey | ROPYORWRWFEFSS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol?
The IUPAC name of [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol (CID 154741364) is [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol.
What is the SMILES notation for [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol?
The canonical SMILES for [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol is OCc1ccnc(NC2CCN(c3ccc(F)cc3F)C2)n1.
What is the InChIKey of [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol?
The InChIKey is ROPYORWRWFEFSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N4O/c16-10-1-2-14(13(17)7-10)21-6-4-11(8-21)19-15-18-5-3-12(9-22)20-15/h1-3,5,7,11,22H,4,6,8-9H2,(H,18,19,20).
What are the key properties of [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol?
[2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol has a molecular weight of 306.32 g/mol, XLogP of 1.94, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]pyrimidin-4-yl]methanol is sourced from PubChem (CID 154741364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).