C14H19NO — CID 112554896
2-[(cyclohex-3-en-1-ylamino)methyl]-6-methylphenol (PubChem CID 112554896) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-[(cyclohex-3-en-1-ylamino)methyl]-6-methylphenol.
| Compound Name | 2-[(cyclohex-3-en-1-ylamino)methyl]-6-methylphenol |
|---|---|
| PubChem CID | 112554896 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-[(cyclohex-3-en-1-ylamino)methyl]-6-methylphenol |
| SMILES | Cc1cccc(CNC2CC=CCC2)c1O |
| InChI | InChI=1S/C14H19NO/c1-11-6-5-7-12(14(11)16)10-15-13-8-3-2-4-9-13/h2-3,5-7,13,15-16H,4,8-10H2,1H3 |
| InChIKey | JGEQPMFNVIOGRB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|