C13H15ClFN — CID 115696005
N-[(3-chloro-2-fluorophenyl)methyl]cyclohex-3-en-1-amine (PubChem CID 115696005) has the molecular formula C13H15ClFN and a molecular weight of 239.72 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]cyclohex-3-en-1-amine.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 115696005 |
| Molecular Formula | C13H15ClFN |
| Molecular Weight | 239.72 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]cyclohex-3-en-1-amine |
| SMILES | Fc1c(Cl)cccc1CNC1CC=CCC1 |
| InChI | InChI=1S/C13H15ClFN/c14-12-8-4-5-10(13(12)15)9-16-11-6-2-1-3-7-11/h1-2,4-5,8,11,16H,3,6-7,9H2 |
| InChIKey | YLOSZRILPXNITO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.72 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|