C8H13N3O2S2 — CID 102768502
2-N-(1,1-dioxothian-3-yl)-1,3-thiazole-2,5-diamine (PubChem CID 102768502) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-N-(1,1-dioxothian-3-yl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(1,1-dioxothian-3-yl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102768502 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-N-(1,1-dioxothian-3-yl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(NC2CCCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C8H13N3O2S2/c9-7-4-10-8(14-7)11-6-2-1-3-15(12,13)5-6/h4,6H,1-3,5,9H2,(H,10,11) |
| InChIKey | LPCNDVACPVQLSF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |