C8H12N2O2S2 — CID 16780957
N-(1,1-dioxothiolan-3-yl)-5-methyl-1,3-thiazol-2-amine (PubChem CID 16780957) has the molecular formula C8H12N2O2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-methyl-1,3-thiazol-2-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 16780957 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1cnc(NC2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C8H12N2O2S2/c1-6-4-9-8(13-6)10-7-2-3-14(11,12)5-7/h4,7H,2-3,5H2,1H3,(H,9,10) |
| InChIKey | LYJXPGOTNBBIGF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |