C8H13N3O2S2 — CID 65272954
N-(1,1-dioxothian-3-yl)-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 65272954) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65272954 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(NC2CCCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C8H13N3O2S2/c1-6-9-8(14-11-6)10-7-3-2-4-15(12,13)5-7/h7H,2-5H2,1H3,(H,9,10,11) |
| InChIKey | NKGGJCYDQUBAJY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |